About 1-(2,3-dimethyl-2H-imidazol-1-yl)-2,2,2-trifluoroethanone
1-(2,3-dimethyl-2H-imidazol-1-yl)-2,2,2-trifluoroethanone (PubChem CID 59609604) has the molecular formula C7H9F3N2O
and a molecular weight of 194.16 g/mol. Its IUPAC name is 1-(2,3-dimethyl-2H-imidazol-1-yl)-2,2,2-trifluoroethanone.
Molecular Properties
| Compound Name | 1-(2,3-dimethyl-2H-imidazol-1-yl)-2,2,2-trifluoroethanone |
| PubChem CID | 59609604 |
| Molecular Formula | C7H9F3N2O |
| Molecular Weight | 194.16 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 1-(2,3-dimethyl-2H-imidazol-1-yl)-2,2,2-trifluoroethanone |
| SMILES | CC1N(C)C=CN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C7H9F3N2O/c1-5-11(2)3-4-12(5)6(13)7(8,9)10/h3-5H,1-2H3 |
| InChIKey | IIVITCGVIWPWHR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.16 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,3-dimethyl-2H-imidazol-1-yl)-2,2,2-trifluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dimethyl-2H-imidazol-1-yl)-2,2,2-trifluoroethanone?
The IUPAC name of 1-(2,3-dimethyl-2H-imidazol-1-yl)-2,2,2-trifluoroethanone (CID 59609604) is 1-(2,3-dimethyl-2H-imidazol-1-yl)-2,2,2-trifluoroethanone.
What is the SMILES notation for 1-(2,3-dimethyl-2H-imidazol-1-yl)-2,2,2-trifluoroethanone?
The canonical SMILES for 1-(2,3-dimethyl-2H-imidazol-1-yl)-2,2,2-trifluoroethanone is CC1N(C)C=CN1C(=O)C(F)(F)F.
What is the InChIKey of 1-(2,3-dimethyl-2H-imidazol-1-yl)-2,2,2-trifluoroethanone?
The InChIKey is IIVITCGVIWPWHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3N2O/c1-5-11(2)3-4-12(5)6(13)7(8,9)10/h3-5H,1-2H3.
What are the key properties of 1-(2,3-dimethyl-2H-imidazol-1-yl)-2,2,2-trifluoroethanone?
1-(2,3-dimethyl-2H-imidazol-1-yl)-2,2,2-trifluoroethanone has a molecular weight of 194.16 g/mol, XLogP of 1.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dimethyl-2H-imidazol-1-yl)-2,2,2-trifluoroethanone is sourced from PubChem (CID 59609604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).