C26H17F3N2O — CID 59609680
4-[3-[4-(1,2,2-trifluoroethenoxy)phenyl]carbazol-9-yl]aniline (PubChem CID 59609680) has the molecular formula C26H17F3N2O and a molecular weight of 430.43 g/mol. Its IUPAC name is 4-[3-[4-(1,2,2-trifluoroethenoxy)phenyl]carbazol-9-yl]aniline.
| Compound Name | 4-[3-[4-(1,2,2-trifluoroethenoxy)phenyl]carbazol-9-yl]aniline |
|---|---|
| PubChem CID | 59609680 |
| Molecular Formula | C26H17F3N2O |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 4-[3-[4-(1,2,2-trifluoroethenoxy)phenyl]carbazol-9-yl]aniline |
| SMILES | Nc1ccc(-n2c3ccccc3c3cc(-c4ccc(OC(F)=C(F)F)cc4)ccc32)cc1 |
| InChI | InChI=1S/C26H17F3N2O/c27-25(28)26(29)32-20-12-5-16(6-13-20)17-7-14-24-22(15-17)21-3-1-2-4-23(21)31(24)19-10-8-18(30)9-11-19/h1-15H,30H2 |
| InChIKey | PTIDSIXPWPKYHV-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|