C21H24BrN5O5S — CID 59610174
methyl N-[(2S)-1-[(2S,4S)-2-[5-(4-bromophenyl)-1H-imidazol-2-yl]-4-isocyanopyrrolidin-1-yl]-4-methylperoxysulfanyl-1-oxobutan-2-yl]carbamate (PubChem CID 59610174) has the molecular formula C21H24BrN5O5S and a molecular weight of 538.42 g/mol. Its IUPAC name is methyl N-[(2S)-1-[(2S,4S)-2-[5-(4-bromophenyl)-1H-imidazol-2-yl]-4-isocyanopyrrolidin-1-yl]-4-methylperoxysulfanyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[(2S,4S)-2-[5-(4-bromophenyl)-1H-imidazol-2-yl]-4-isocyanopyrrolidin-1-yl]-4-methylperoxysulfanyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 59610174 |
| Molecular Formula | C21H24BrN5O5S |
| Molecular Weight | 538.42 g/mol |
| Exact Mass | 537.07 |
| IUPAC Name | methyl N-[(2S)-1-[(2S,4S)-2-[5-(4-bromophenyl)-1H-imidazol-2-yl]-4-isocyanopyrrolidin-1-yl]-4-methylperoxysulfanyl-1-oxobutan-2-yl]carbamate |
| SMILES | [C-]#[N+][C@H]1C[C@@H](c2ncc(-c3ccc(Br)cc3)[nH]2)N(C(=O)[C@H](CCSOOC)NC(=O)OC)C1 |
| InChI | InChI=1S/C21H24BrN5O5S/c1-23-15-10-18(19-24-11-17(25-19)13-4-6-14(22)7-5-13)27(12-15)20(28)16(26-21(29)30-2)8-9-33-32-31-3/h4-7,11,15-16,18H,8-10,12H2,2-3H3,(H,24,25)(H,26,29)/t15-,16-,18-/m0/s1 |
| InChIKey | AZBQBRFADLXGBX-BQFCYCMXSA-N |
| XLogP | 3.74 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|