About [2-(6-bromonaphthalen-2-yl)-2-oxoethyl] (2S)-4,4-difluoropyrrolidine-2-carboxylate
[2-(6-bromonaphthalen-2-yl)-2-oxoethyl] (2S)-4,4-difluoropyrrolidine-2-carboxylate (PubChem CID 59611322) has the molecular formula C17H14BrF2NO3
and a molecular weight of 398.20 g/mol. Its IUPAC name is [2-(6-bromonaphthalen-2-yl)-2-oxoethyl] (2S)-4,4-difluoropyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | [2-(6-bromonaphthalen-2-yl)-2-oxoethyl] (2S)-4,4-difluoropyrrolidine-2-carboxylate |
| PubChem CID | 59611322 |
| Molecular Formula | C17H14BrF2NO3 |
| Molecular Weight | 398.20 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | [2-(6-bromonaphthalen-2-yl)-2-oxoethyl] (2S)-4,4-difluoropyrrolidine-2-carboxylate |
| SMILES | O=C(COC(=O)[C@@H]1CC(F)(F)CN1)c1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C17H14BrF2NO3/c18-13-4-3-10-5-12(2-1-11(10)6-13)15(22)8-24-16(23)14-7-17(19,20)9-21-14/h1-6,14,21H,7-9H2/t14-/m0/s1 |
| InChIKey | LNRLGNGEJRBIQY-AWEZNQCLSA-N |
| XLogP | 3.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.20 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(6-bromonaphthalen-2-yl)-2-oxoethyl] (2S)-4,4-difluoropyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(6-bromonaphthalen-2-yl)-2-oxoethyl] (2S)-4,4-difluoropyrrolidine-2-carboxylate?
The IUPAC name of [2-(6-bromonaphthalen-2-yl)-2-oxoethyl] (2S)-4,4-difluoropyrrolidine-2-carboxylate (CID 59611322) is [2-(6-bromonaphthalen-2-yl)-2-oxoethyl] (2S)-4,4-difluoropyrrolidine-2-carboxylate.
What is the SMILES notation for [2-(6-bromonaphthalen-2-yl)-2-oxoethyl] (2S)-4,4-difluoropyrrolidine-2-carboxylate?
The canonical SMILES for [2-(6-bromonaphthalen-2-yl)-2-oxoethyl] (2S)-4,4-difluoropyrrolidine-2-carboxylate is O=C(COC(=O)[C@@H]1CC(F)(F)CN1)c1ccc2cc(Br)ccc2c1.
What is the InChIKey of [2-(6-bromonaphthalen-2-yl)-2-oxoethyl] (2S)-4,4-difluoropyrrolidine-2-carboxylate?
The InChIKey is LNRLGNGEJRBIQY-AWEZNQCLSA-N. The full InChI is InChI=1S/C17H14BrF2NO3/c18-13-4-3-10-5-12(2-1-11(10)6-13)15(22)8-24-16(23)14-7-17(19,20)9-21-14/h1-6,14,21H,7-9H2/t14-/m0/s1.
What are the key properties of [2-(6-bromonaphthalen-2-yl)-2-oxoethyl] (2S)-4,4-difluoropyrrolidine-2-carboxylate?
[2-(6-bromonaphthalen-2-yl)-2-oxoethyl] (2S)-4,4-difluoropyrrolidine-2-carboxylate has a molecular weight of 398.20 g/mol, XLogP of 3.33, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(6-bromonaphthalen-2-yl)-2-oxoethyl] (2S)-4,4-difluoropyrrolidine-2-carboxylate is sourced from PubChem (CID 59611322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).