C34H41N3O7 — CID 59612286
(3R,4R,6R)-5-amino-6-[(1S,2R,4R)-4,6-diamino-3-hydroxy-2-(naphthalen-2-ylmethoxy)cyclohexyl]oxy-2-(hydroxymethyl)-4-(naphthalen-2-ylmethoxy)oxan-3-ol (PubChem CID 59612286) has the molecular formula C34H41N3O7 and a molecular weight of 603.72 g/mol. Its IUPAC name is (3R,4R,6R)-5-amino-6-[(1S,2R,4R)-4,6-diamino-3-hydroxy-2-(naphthalen-2-ylmethoxy)cyclohexyl]oxy-2-(hydroxymethyl)-4-(naphthalen-2-ylmethoxy)oxan-3-ol.
| Compound Name | (3R,4R,6R)-5-amino-6-[(1S,2R,4R)-4,6-diamino-3-hydroxy-2-(naphthalen-2-ylmethoxy)cyclohexyl]oxy-2-(hydroxymethyl)-4-(naphthalen-2-ylmethoxy)oxan-3-ol |
|---|---|
| PubChem CID | 59612286 |
| Molecular Formula | C34H41N3O7 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.29 |
| IUPAC Name | (3R,4R,6R)-5-amino-6-[(1S,2R,4R)-4,6-diamino-3-hydroxy-2-(naphthalen-2-ylmethoxy)cyclohexyl]oxy-2-(hydroxymethyl)-4-(naphthalen-2-ylmethoxy)oxan-3-ol |
| SMILES | NC1[C@H](O[C@H]2C(N)C[C@@H](N)C(O)[C@H]2OCc2ccc3ccccc3c2)OC(CO)[C@H](O)[C@@H]1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C34H41N3O7/c35-25-15-26(36)31(33(29(25)39)42-18-20-10-12-22-6-2-4-8-24(22)14-20)44-34-28(37)32(30(40)27(16-38)43-34)41-17-19-9-11-21-5-1-3-7-23(21)13-19/h1-14,25-34,38-40H,15-18,35-37H2/t25-,26?,27?,28?,29?,30+,31+,32-,33-,34+/m1/s1 |
| InChIKey | XLDCSETZLQDRAA-OSGDPSCJSA-N |
| XLogP | 1.67 |
| TPSA | 175.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |