C29H31N7O2 — CID 59612433
tert-butyl 7-[[8-(1-methylindazol-4-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate (PubChem CID 59612433) has the molecular formula C29H31N7O2 and a molecular weight of 509.61 g/mol. Its IUPAC name is tert-butyl 7-[[8-(1-methylindazol-4-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate.
| Compound Name | tert-butyl 7-[[8-(1-methylindazol-4-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate |
|---|---|
| PubChem CID | 59612433 |
| Molecular Formula | C29H31N7O2 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | tert-butyl 7-[[8-(1-methylindazol-4-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate |
| SMILES | Cn1ncc2c(-c3cccn4nc(Nc5ccc6c(c5)CCN(C(=O)OC(C)(C)C)CC6)nc34)cccc21 |
| InChI | InChI=1S/C29H31N7O2/c1-29(2,3)38-28(37)35-15-12-19-10-11-21(17-20(19)13-16-35)31-27-32-26-23(8-6-14-36(26)33-27)22-7-5-9-25-24(22)18-30-34(25)4/h5-11,14,17-18H,12-13,15-16H2,1-4H3,(H,31,33) |
| InChIKey | MAZKPYXDQCNDAZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 89.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |