About 8-bromo-1-(2,6-dimethoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-one
8-bromo-1-(2,6-dimethoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-one (PubChem CID 59612940) has the molecular formula C18H15BrN4O3
and a molecular weight of 415.25 g/mol. Its IUPAC name is 8-bromo-1-(2,6-dimethoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-one.
Molecular Properties
| Compound Name | 8-bromo-1-(2,6-dimethoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-one |
| PubChem CID | 59612940 |
| Molecular Formula | C18H15BrN4O3 |
| Molecular Weight | 415.25 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 8-bromo-1-(2,6-dimethoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-one |
| SMILES | COc1ccc(-n2c(=O)n(C)c3cnc4ccc(Br)cc4c32)c(OC)n1 |
| InChI | InChI=1S/C18H15BrN4O3/c1-22-14-9-20-12-5-4-10(19)8-11(12)16(14)23(18(22)24)13-6-7-15(25-2)21-17(13)26-3/h4-9H,1-3H3 |
| InChIKey | JCFDYHQOCUTFLJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.25 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 8-bromo-1-(2,6-dimethoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-1-(2,6-dimethoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-one?
The IUPAC name of 8-bromo-1-(2,6-dimethoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-one (CID 59612940) is 8-bromo-1-(2,6-dimethoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-one.
What is the SMILES notation for 8-bromo-1-(2,6-dimethoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-one?
The canonical SMILES for 8-bromo-1-(2,6-dimethoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-one is COc1ccc(-n2c(=O)n(C)c3cnc4ccc(Br)cc4c32)c(OC)n1.
What is the InChIKey of 8-bromo-1-(2,6-dimethoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-one?
The InChIKey is JCFDYHQOCUTFLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15BrN4O3/c1-22-14-9-20-12-5-4-10(19)8-11(12)16(14)23(18(22)24)13-6-7-15(25-2)21-17(13)26-3/h4-9H,1-3H3.
What are the key properties of 8-bromo-1-(2,6-dimethoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-one?
8-bromo-1-(2,6-dimethoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-one has a molecular weight of 415.25 g/mol, XLogP of 3.05, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-1-(2,6-dimethoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-one is sourced from PubChem (CID 59612940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).