About 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydronaphthalene
5-methyl-6-propan-2-yl-1,2,3,4-tetrahydronaphthalene (PubChem CID 59613678) has the molecular formula C14H20
and a molecular weight of 188.31 g/mol. Its IUPAC name is 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydronaphthalene.
Molecular Properties
| Compound Name | 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydronaphthalene |
| PubChem CID | 59613678 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydronaphthalene |
| SMILES | Cc1c(C(C)C)ccc2c1CCCC2 |
| InChI | InChI=1S/C14H20/c1-10(2)13-9-8-12-6-4-5-7-14(12)11(13)3/h8-10H,4-7H2,1-3H3 |
| InChIKey | DKPAIONABPQVDL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydronaphthalene?
The IUPAC name of 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydronaphthalene (CID 59613678) is 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydronaphthalene.
What is the SMILES notation for 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydronaphthalene?
The canonical SMILES for 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydronaphthalene is Cc1c(C(C)C)ccc2c1CCCC2.
What is the InChIKey of 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydronaphthalene?
The InChIKey is DKPAIONABPQVDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20/c1-10(2)13-9-8-12-6-4-5-7-14(12)11(13)3/h8-10H,4-7H2,1-3H3.
What are the key properties of 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydronaphthalene?
5-methyl-6-propan-2-yl-1,2,3,4-tetrahydronaphthalene has a molecular weight of 188.31 g/mol, XLogP of 4.00, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-6-propan-2-yl-1,2,3,4-tetrahydronaphthalene is sourced from PubChem (CID 59613678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).