C20H18ClF4N5O2 — CID 59613989
cis-(1S,4S)-2-[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]-4-hydroxy-4-methyl-N-(2,2,2-trifluoroethyl)cyclopentane-1-carboxamide (PubChem CID 59613989) has the molecular formula C20H18ClF4N5O2 and a molecular weight of 471.84 g/mol. Its IUPAC name is cis-(1S,4S)-2-[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]-4-hydroxy-4-methyl-N-(2,2,2-trifluoroethyl)cyclopentane-1-carboxamide.
| Compound Name | cis-(1S,4S)-2-[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]-4-hydroxy-4-methyl-N-(2,2,2-trifluoroethyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 59613989 |
| Molecular Formula | C20H18ClF4N5O2 |
| Molecular Weight | 471.84 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | cis-(1S,4S)-2-[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]-4-hydroxy-4-methyl-N-(2,2,2-trifluoroethyl)cyclopentane-1-carboxamide |
| SMILES | C[C@]1(O)CC(c2nc(-c3c[nH]c4ncc(Cl)cc34)ncc2F)[C@@H](C(=O)NCC(F)(F)F)C1 |
| InChI | InChI=1S/C20H18ClF4N5O2/c1-19(32)3-11(12(4-19)18(31)29-8-20(23,24)25)15-14(22)7-28-17(30-15)13-6-27-16-10(13)2-9(21)5-26-16/h2,5-7,11-12,32H,3-4,8H2,1H3,(H,26,27)(H,29,31)/t11?,12-,19-/m0/s1 |
| InChIKey | OZQVCQFQVRRCIL-XGEIWLPHSA-N |
| XLogP | 3.74 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.84 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |