C10H23NO2S — CID 59614241
N-(2,2,4,4-tetramethylpentan-3-yl)methanesulfonamide (PubChem CID 59614241) has the molecular formula C10H23NO2S and a molecular weight of 221.37 g/mol. Its IUPAC name is N-(2,2,4,4-tetramethylpentan-3-yl)methanesulfonamide.
| Compound Name | N-(2,2,4,4-tetramethylpentan-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 59614241 |
| Molecular Formula | C10H23NO2S |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | N-(2,2,4,4-tetramethylpentan-3-yl)methanesulfonamide |
| SMILES | CC(C)(C)C(NS(C)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C10H23NO2S/c1-9(2,3)8(10(4,5)6)11-14(7,12)13/h8,11H,1-7H3 |
| InChIKey | LQMATQKUXJTCDZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |