C11H18N2O — CID 59614272
(3aS,6aR)-N,N-dimethyl-5-methylidene-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide (PubChem CID 59614272) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is (3aS,6aR)-N,N-dimethyl-5-methylidene-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | (3aS,6aR)-N,N-dimethyl-5-methylidene-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 59614272 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (3aS,6aR)-N,N-dimethyl-5-methylidene-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
| SMILES | C=C1C[C@@H]2CN(C(=O)N(C)C)C[C@@H]2C1 |
| InChI | InChI=1S/C11H18N2O/c1-8-4-9-6-13(7-10(9)5-8)11(14)12(2)3/h9-10H,1,4-7H2,2-3H3/t9-,10+ |
| InChIKey | XNTUKPBCFKXFIX-AOOOYVTPSA-N |
| XLogP | 1.57 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|