C12H23N3O — CID 59614273
(3aS,6aR)-5-amino-5-ethyl-N,N-dimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide (PubChem CID 59614273) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is (3aS,6aR)-5-amino-5-ethyl-N,N-dimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | (3aS,6aR)-5-amino-5-ethyl-N,N-dimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 59614273 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | (3aS,6aR)-5-amino-5-ethyl-N,N-dimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
| SMILES | CCC1(N)C[C@H]2CN(C(=O)N(C)C)C[C@H]2C1 |
| InChI | InChI=1S/C12H23N3O/c1-4-12(13)5-9-7-15(8-10(9)6-12)11(16)14(2)3/h9-10H,4-8,13H2,1-3H3/t9-,10+,12? |
| InChIKey | HJYKOFZGXYYBMZ-DHHPTOIESA-N |
| XLogP | 1.12 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |