C12H19N3O — CID 59614297
(3aR,6aS)-5-isocyano-N,N,5-trimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide (PubChem CID 59614297) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is (3aR,6aS)-5-isocyano-N,N,5-trimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | (3aR,6aS)-5-isocyano-N,N,5-trimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 59614297 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | (3aR,6aS)-5-isocyano-N,N,5-trimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
| SMILES | [C-]#[N+]C1(C)C[C@H]2CN(C(=O)N(C)C)C[C@H]2C1 |
| InChI | InChI=1S/C12H19N3O/c1-12(13-2)5-9-7-15(8-10(9)6-12)11(16)14(3)4/h9-10H,5-8H2,1,3-4H3/t9-,10+,12? |
| InChIKey | KUJPBYPSHNQMCA-DHHPTOIESA-N |
| XLogP | 1.69 |
| TPSA | 27.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|