C13H21N3O2 — CID 59614299
(3aS,6aR)-N,N,5-trimethyl-5-(2-oxoethylideneamino)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide (PubChem CID 59614299) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is (3aS,6aR)-N,N,5-trimethyl-5-(2-oxoethylideneamino)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | (3aS,6aR)-N,N,5-trimethyl-5-(2-oxoethylideneamino)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 59614299 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | (3aS,6aR)-N,N,5-trimethyl-5-(2-oxoethylideneamino)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
| SMILES | CN(C)C(=O)N1C[C@@H]2CC(C)(/N=C/C=O)C[C@@H]2C1 |
| InChI | InChI=1S/C13H21N3O2/c1-13(14-4-5-17)6-10-8-16(9-11(10)7-13)12(18)15(2)3/h4-5,10-11H,6-9H2,1-3H3/b14-4+/t10-,11+,13? |
| InChIKey | OGPROVAFIRHXQJ-SKUSUMRBSA-N |
| XLogP | 1.04 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|