C17H31N3O — CID 59614301
(3aR,6aS)-5-amino-5-(cyclohexylmethyl)-N,N-dimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide (PubChem CID 59614301) has the molecular formula C17H31N3O and a molecular weight of 293.45 g/mol. Its IUPAC name is (3aR,6aS)-5-amino-5-(cyclohexylmethyl)-N,N-dimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | (3aR,6aS)-5-amino-5-(cyclohexylmethyl)-N,N-dimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 59614301 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | (3aR,6aS)-5-amino-5-(cyclohexylmethyl)-N,N-dimethyl-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
| SMILES | CN(C)C(=O)N1C[C@@H]2CC(N)(CC3CCCCC3)C[C@@H]2C1 |
| InChI | InChI=1S/C17H31N3O/c1-19(2)16(21)20-11-14-9-17(18,10-15(14)12-20)8-13-6-4-3-5-7-13/h13-15H,3-12,18H2,1-2H3/t14-,15+,17? |
| InChIKey | USNABPCGRMEGEC-FKEKPDDDSA-N |
| XLogP | 2.68 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |