C29H27FN2O3 — CID 59614448
1-(3-fluoro-5-morpholin-4-ylphenyl)-2-[4-(2-pyridin-3-ylethoxy)naphthalen-1-yl]ethanone (PubChem CID 59614448) has the molecular formula C29H27FN2O3 and a molecular weight of 470.54 g/mol. Its IUPAC name is 1-(3-fluoro-5-morpholin-4-ylphenyl)-2-[4-(2-pyridin-3-ylethoxy)naphthalen-1-yl]ethanone.
| Compound Name | 1-(3-fluoro-5-morpholin-4-ylphenyl)-2-[4-(2-pyridin-3-ylethoxy)naphthalen-1-yl]ethanone |
|---|---|
| PubChem CID | 59614448 |
| Molecular Formula | C29H27FN2O3 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 1-(3-fluoro-5-morpholin-4-ylphenyl)-2-[4-(2-pyridin-3-ylethoxy)naphthalen-1-yl]ethanone |
| SMILES | O=C(Cc1ccc(OCCc2cccnc2)c2ccccc12)c1cc(F)cc(N2CCOCC2)c1 |
| InChI | InChI=1S/C29H27FN2O3/c30-24-16-23(17-25(19-24)32-11-14-34-15-12-32)28(33)18-22-7-8-29(27-6-2-1-5-26(22)27)35-13-9-21-4-3-10-31-20-21/h1-8,10,16-17,19-20H,9,11-15,18H2 |
| InChIKey | RUJPIWBZLFXRQZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |