C8H13N3O3 — CID 59614605
8-methoxy-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 59614605) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 8-methoxy-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-methoxy-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 59614605 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 8-methoxy-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CON1CCC2(CC1)NC(=O)NC2=O |
| InChI | InChI=1S/C8H13N3O3/c1-14-11-4-2-8(3-5-11)6(12)9-7(13)10-8/h2-5H2,1H3,(H2,9,10,12,13) |
| InChIKey | HSMMVBOTEZPXTM-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|