About 1-chloroethyl [(3R)-3-nitrooxybutyl] carbonate
1-chloroethyl [(3R)-3-nitrooxybutyl] carbonate (PubChem CID 59614875) has the molecular formula C7H12ClNO6
and a molecular weight of 241.63 g/mol. Its IUPAC name is 1-chloroethyl [(3R)-3-nitrooxybutyl] carbonate.
Molecular Properties
| Compound Name | 1-chloroethyl [(3R)-3-nitrooxybutyl] carbonate |
| PubChem CID | 59614875 |
| Molecular Formula | C7H12ClNO6 |
| Molecular Weight | 241.63 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 1-chloroethyl [(3R)-3-nitrooxybutyl] carbonate |
| SMILES | CC(Cl)OC(=O)OCC[C@@H](C)O[N+](=O)[O-] |
| InChI | InChI=1S/C7H12ClNO6/c1-5(15-9(11)12)3-4-13-7(10)14-6(2)8/h5-6H,3-4H2,1-2H3/t5-,6?/m1/s1 |
| InChIKey | JIHMROAIPFPYSE-LWOQYNTDSA-N |
| XLogP | 1.71 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.63 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-chloroethyl [(3R)-3-nitrooxybutyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloroethyl [(3R)-3-nitrooxybutyl] carbonate?
The IUPAC name of 1-chloroethyl [(3R)-3-nitrooxybutyl] carbonate (CID 59614875) is 1-chloroethyl [(3R)-3-nitrooxybutyl] carbonate.
What is the SMILES notation for 1-chloroethyl [(3R)-3-nitrooxybutyl] carbonate?
The canonical SMILES for 1-chloroethyl [(3R)-3-nitrooxybutyl] carbonate is CC(Cl)OC(=O)OCC[C@@H](C)O[N+](=O)[O-].
What is the InChIKey of 1-chloroethyl [(3R)-3-nitrooxybutyl] carbonate?
The InChIKey is JIHMROAIPFPYSE-LWOQYNTDSA-N. The full InChI is InChI=1S/C7H12ClNO6/c1-5(15-9(11)12)3-4-13-7(10)14-6(2)8/h5-6H,3-4H2,1-2H3/t5-,6?/m1/s1.
What are the key properties of 1-chloroethyl [(3R)-3-nitrooxybutyl] carbonate?
1-chloroethyl [(3R)-3-nitrooxybutyl] carbonate has a molecular weight of 241.63 g/mol, XLogP of 1.71, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloroethyl [(3R)-3-nitrooxybutyl] carbonate is sourced from PubChem (CID 59614875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).