methyl 5-methyl-1,3-oxathiolane-2-carboxylate

C6H10O3S — CID 59615225

IUPACmethyl 5-methyl-1,3-oxathiolane-2-carboxylate
SMILESCOC(=O)C1OC(C)CS1
InChIInChI=1S/C6H10O3S/c1-4-3-10-6(9-4)5(7)8-2/h4,6H,3H2,1-2H3
InChIKeyUXROXYNLAIMOAI-UHFFFAOYSA-N
MW162.21 g/mol
LogP0.64
Rot. Bonds1

About methyl 5-methyl-1,3-oxathiolane-2-carboxylate

methyl 5-methyl-1,3-oxathiolane-2-carboxylate (PubChem CID 59615225) has the molecular formula C6H10O3S and a molecular weight of 162.21 g/mol. Its IUPAC name is methyl 5-methyl-1,3-oxathiolane-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-methyl-1,3-oxathiolane-2-carboxylate
PubChem CID59615225
Molecular FormulaC6H10O3S
Molecular Weight162.21 g/mol
Exact Mass162.04
IUPAC Namemethyl 5-methyl-1,3-oxathiolane-2-carboxylate
SMILESCOC(=O)C1OC(C)CS1
InChIInChI=1S/C6H10O3S/c1-4-3-10-6(9-4)5(7)8-2/h4,6H,3H2,1-2H3
InChIKeyUXROXYNLAIMOAI-UHFFFAOYSA-N
XLogP0.64
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.21
LogP ≤ 50.64
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 5-methyl-1,3-oxathiolane-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-methyl-1,3-oxathiolane-2-carboxylate?
The IUPAC name of methyl 5-methyl-1,3-oxathiolane-2-carboxylate (CID 59615225) is methyl 5-methyl-1,3-oxathiolane-2-carboxylate.
What is the SMILES notation for methyl 5-methyl-1,3-oxathiolane-2-carboxylate?
The canonical SMILES for methyl 5-methyl-1,3-oxathiolane-2-carboxylate is COC(=O)C1OC(C)CS1.
What is the InChIKey of methyl 5-methyl-1,3-oxathiolane-2-carboxylate?
The InChIKey is UXROXYNLAIMOAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3S/c1-4-3-10-6(9-4)5(7)8-2/h4,6H,3H2,1-2H3.
What are the key properties of methyl 5-methyl-1,3-oxathiolane-2-carboxylate?
methyl 5-methyl-1,3-oxathiolane-2-carboxylate has a molecular weight of 162.21 g/mol, XLogP of 0.64, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methyl-1,3-oxathiolane-2-carboxylate is sourced from PubChem (CID 59615225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).