About methyl 5-methyl-1,3-oxathiolane-2-carboxylate
methyl 5-methyl-1,3-oxathiolane-2-carboxylate (PubChem CID 59615225) has the molecular formula C6H10O3S
and a molecular weight of 162.21 g/mol. Its IUPAC name is methyl 5-methyl-1,3-oxathiolane-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-methyl-1,3-oxathiolane-2-carboxylate |
| PubChem CID | 59615225 |
| Molecular Formula | C6H10O3S |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | methyl 5-methyl-1,3-oxathiolane-2-carboxylate |
| SMILES | COC(=O)C1OC(C)CS1 |
| InChI | InChI=1S/C6H10O3S/c1-4-3-10-6(9-4)5(7)8-2/h4,6H,3H2,1-2H3 |
| InChIKey | UXROXYNLAIMOAI-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-methyl-1,3-oxathiolane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-methyl-1,3-oxathiolane-2-carboxylate?
The IUPAC name of methyl 5-methyl-1,3-oxathiolane-2-carboxylate (CID 59615225) is methyl 5-methyl-1,3-oxathiolane-2-carboxylate.
What is the SMILES notation for methyl 5-methyl-1,3-oxathiolane-2-carboxylate?
The canonical SMILES for methyl 5-methyl-1,3-oxathiolane-2-carboxylate is COC(=O)C1OC(C)CS1.
What is the InChIKey of methyl 5-methyl-1,3-oxathiolane-2-carboxylate?
The InChIKey is UXROXYNLAIMOAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3S/c1-4-3-10-6(9-4)5(7)8-2/h4,6H,3H2,1-2H3.
What are the key properties of methyl 5-methyl-1,3-oxathiolane-2-carboxylate?
methyl 5-methyl-1,3-oxathiolane-2-carboxylate has a molecular weight of 162.21 g/mol, XLogP of 0.64, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methyl-1,3-oxathiolane-2-carboxylate is sourced from PubChem (CID 59615225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).