C21H25N7 — CID 59615302
N',N'-dimethyl-N-[[6-[(8-methylquinazolin-2-yl)amino]-2H-indazol-3-yl]methyl]ethane-1,2-diamine (PubChem CID 59615302) has the molecular formula C21H25N7 and a molecular weight of 375.48 g/mol. Its IUPAC name is N',N'-dimethyl-N-[[6-[(8-methylquinazolin-2-yl)amino]-2H-indazol-3-yl]methyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[[6-[(8-methylquinazolin-2-yl)amino]-2H-indazol-3-yl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 59615302 |
| Molecular Formula | C21H25N7 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | N',N'-dimethyl-N-[[6-[(8-methylquinazolin-2-yl)amino]-2H-indazol-3-yl]methyl]ethane-1,2-diamine |
| SMILES | Cc1cccc2cnc(Nc3ccc4c(CNCCN(C)C)[nH]nc4c3)nc12 |
| InChI | InChI=1S/C21H25N7/c1-14-5-4-6-15-12-23-21(25-20(14)15)24-16-7-8-17-18(11-16)26-27-19(17)13-22-9-10-28(2)3/h4-8,11-12,22H,9-10,13H2,1-3H3,(H,26,27)(H,23,24,25) |
| InChIKey | URJWPLOHMVGUDU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|