C18H19N7O — CID 59615316
2-[[2-[(4-amino-1H-indazol-6-yl)amino]-8-methylquinazolin-7-yl]amino]ethanol (PubChem CID 59615316) has the molecular formula C18H19N7O and a molecular weight of 349.40 g/mol. Its IUPAC name is 2-[[2-[(4-amino-1H-indazol-6-yl)amino]-8-methylquinazolin-7-yl]amino]ethanol.
| Compound Name | 2-[[2-[(4-amino-1H-indazol-6-yl)amino]-8-methylquinazolin-7-yl]amino]ethanol |
|---|---|
| PubChem CID | 59615316 |
| Molecular Formula | C18H19N7O |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 2-[[2-[(4-amino-1H-indazol-6-yl)amino]-8-methylquinazolin-7-yl]amino]ethanol |
| SMILES | Cc1c(NCCO)ccc2cnc(Nc3cc(N)c4cn[nH]c4c3)nc12 |
| InChI | InChI=1S/C18H19N7O/c1-10-15(20-4-5-26)3-2-11-8-21-18(24-17(10)11)23-12-6-14(19)13-9-22-25-16(13)7-12/h2-3,6-9,20,26H,4-5,19H2,1H3,(H,22,25)(H,21,23,24) |
| InChIKey | QKWBIFGEADAHQZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|