About 2-[4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]phenyl]-1,3-thiazole-5-carboxylic acid
2-[4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]phenyl]-1,3-thiazole-5-carboxylic acid (PubChem CID 59615401) has the molecular formula C16H13ClN4O3S
and a molecular weight of 376.83 g/mol. Its IUPAC name is 2-[4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]phenyl]-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-[4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]phenyl]-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 59615401 |
| Molecular Formula | C16H13ClN4O3S |
| Molecular Weight | 376.83 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 2-[4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]phenyl]-1,3-thiazole-5-carboxylic acid |
| SMILES | CCc1[nH]c(C(=O)Nc2ccc(-c3ncc(C(=O)O)s3)cc2)nc1Cl |
| InChI | InChI=1S/C16H13ClN4O3S/c1-2-10-12(17)21-13(20-10)14(22)19-9-5-3-8(4-6-9)15-18-7-11(25-15)16(23)24/h3-7H,2H2,1H3,(H,19,22)(H,20,21)(H,23,24) |
| InChIKey | RQHLUGGRUCFAHV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.83 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]phenyl]-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]phenyl]-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-[4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]phenyl]-1,3-thiazole-5-carboxylic acid (CID 59615401) is 2-[4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]phenyl]-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-[4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]phenyl]-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-[4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]phenyl]-1,3-thiazole-5-carboxylic acid is CCc1[nH]c(C(=O)Nc2ccc(-c3ncc(C(=O)O)s3)cc2)nc1Cl.
What is the InChIKey of 2-[4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]phenyl]-1,3-thiazole-5-carboxylic acid?
The InChIKey is RQHLUGGRUCFAHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClN4O3S/c1-2-10-12(17)21-13(20-10)14(22)19-9-5-3-8(4-6-9)15-18-7-11(25-15)16(23)24/h3-7H,2H2,1H3,(H,19,22)(H,20,21)(H,23,24).
What are the key properties of 2-[4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]phenyl]-1,3-thiazole-5-carboxylic acid?
2-[4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]phenyl]-1,3-thiazole-5-carboxylic acid has a molecular weight of 376.83 g/mol, XLogP of 3.70, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]phenyl]-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 59615401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).