C35H32ClF3N2Pt — CID 59615520
chloroplatinum(1+);3-[4-(3,5-ditert-butylphenyl)-6-[3-(trifluoromethyl)benzene-6-id-1-yl]-2-pyridinyl]isoquinoline (PubChem CID 59615520) has the molecular formula C35H32ClF3N2Pt and a molecular weight of 768.18 g/mol. Its IUPAC name is chloroplatinum(1+);3-[4-(3,5-ditert-butylphenyl)-6-[3-(trifluoromethyl)benzene-6-id-1-yl]-2-pyridinyl]isoquinoline.
| Compound Name | chloroplatinum(1+);3-[4-(3,5-ditert-butylphenyl)-6-[3-(trifluoromethyl)benzene-6-id-1-yl]-2-pyridinyl]isoquinoline |
|---|---|
| PubChem CID | 59615520 |
| Molecular Formula | C35H32ClF3N2Pt |
| Molecular Weight | 768.18 g/mol |
| Exact Mass | 767.19 |
| IUPAC Name | chloroplatinum(1+);3-[4-(3,5-ditert-butylphenyl)-6-[3-(trifluoromethyl)benzene-6-id-1-yl]-2-pyridinyl]isoquinoline |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3[c-]ccc(C(F)(F)F)c3)nc(-c3cc4ccccc4cn3)c2)cc(C(C)(C)C)c1.Cl[Pt+] |
| InChI | InChI=1S/C35H32F3N2.ClH.Pt/c1-33(2,3)28-15-25(16-29(20-28)34(4,5)6)26-18-30(23-12-9-13-27(14-23)35(36,37)38)40-32(19-26)31-17-22-10-7-8-11-24(22)21-39-31;;/h7-11,13-21H,1-6H3;1H;/q-1;;+2/p-1 |
| InChIKey | WDAMIEVTDGXBAH-UHFFFAOYSA-M |
| XLogP | 10.73 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.18 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|