C23H36N2O4 — CID 59615693
tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-(1,1,3,3-tetramethyl-2H-inden-5-yl)carbamate (PubChem CID 59615693) has the molecular formula C23H36N2O4 and a molecular weight of 404.55 g/mol. Its IUPAC name is tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-(1,1,3,3-tetramethyl-2H-inden-5-yl)carbamate.
| Compound Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-(1,1,3,3-tetramethyl-2H-inden-5-yl)carbamate |
|---|---|
| PubChem CID | 59615693 |
| Molecular Formula | C23H36N2O4 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-(1,1,3,3-tetramethyl-2H-inden-5-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NN(C(=O)OC(C)(C)C)c1ccc2c(c1)C(C)(C)CC2(C)C |
| InChI | InChI=1S/C23H36N2O4/c1-20(2,3)28-18(26)24-25(19(27)29-21(4,5)6)15-11-12-16-17(13-15)23(9,10)14-22(16,7)8/h11-13H,14H2,1-10H3,(H,24,26) |
| InChIKey | SZHVTBIWYCXTDF-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|