C20H20N6O2S — CID 59615713
1-[2-(cyclopropylmethoxy)ethyl]-3-[4-methyl-5-(2-pyrido[2,3-b]pyrazin-7-ylethynyl)-1,3-thiazol-2-yl]urea (PubChem CID 59615713) has the molecular formula C20H20N6O2S and a molecular weight of 408.49 g/mol. Its IUPAC name is 1-[2-(cyclopropylmethoxy)ethyl]-3-[4-methyl-5-(2-pyrido[2,3-b]pyrazin-7-ylethynyl)-1,3-thiazol-2-yl]urea.
| Compound Name | 1-[2-(cyclopropylmethoxy)ethyl]-3-[4-methyl-5-(2-pyrido[2,3-b]pyrazin-7-ylethynyl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 59615713 |
| Molecular Formula | C20H20N6O2S |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 1-[2-(cyclopropylmethoxy)ethyl]-3-[4-methyl-5-(2-pyrido[2,3-b]pyrazin-7-ylethynyl)-1,3-thiazol-2-yl]urea |
| SMILES | Cc1nc(NC(=O)NCCOCC2CC2)sc1C#Cc1cnc2nccnc2c1 |
| InChI | InChI=1S/C20H20N6O2S/c1-13-17(5-4-15-10-16-18(24-11-15)22-7-6-21-16)29-20(25-13)26-19(27)23-8-9-28-12-14-2-3-14/h6-7,10-11,14H,2-3,8-9,12H2,1H3,(H2,23,25,26,27) |
| InChIKey | RMWZHPCZUMHPGY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|