C20H21N5O2S — CID 59615718
1-[2-(cyclopropylmethoxy)ethyl]-3-[4-methyl-5-[2-(1H-pyrrolo[2,3-b]pyridin-5-yl)ethynyl]-1,3-thiazol-2-yl]urea (PubChem CID 59615718) has the molecular formula C20H21N5O2S and a molecular weight of 395.49 g/mol. Its IUPAC name is 1-[2-(cyclopropylmethoxy)ethyl]-3-[4-methyl-5-[2-(1H-pyrrolo[2,3-b]pyridin-5-yl)ethynyl]-1,3-thiazol-2-yl]urea.
| Compound Name | 1-[2-(cyclopropylmethoxy)ethyl]-3-[4-methyl-5-[2-(1H-pyrrolo[2,3-b]pyridin-5-yl)ethynyl]-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 59615718 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 1-[2-(cyclopropylmethoxy)ethyl]-3-[4-methyl-5-[2-(1H-pyrrolo[2,3-b]pyridin-5-yl)ethynyl]-1,3-thiazol-2-yl]urea |
| SMILES | Cc1nc(NC(=O)NCCOCC2CC2)sc1C#Cc1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C20H21N5O2S/c1-13-17(5-4-15-10-16-6-7-21-18(16)23-11-15)28-20(24-13)25-19(26)22-8-9-27-12-14-2-3-14/h6-7,10-11,14H,2-3,8-9,12H2,1H3,(H,21,23)(H2,22,24,25,26) |
| InChIKey | SANKLTIPXBLFAY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|