C18H17F3N4O2S — CID 59615749
N'-[4-methyl-5-(2-pyridin-4-ylethynyl)-1,3-thiazol-2-yl]-N-(2,2,2-trifluoroethyl)pentanediamide (PubChem CID 59615749) has the molecular formula C18H17F3N4O2S and a molecular weight of 410.42 g/mol. Its IUPAC name is N'-[4-methyl-5-(2-pyridin-4-ylethynyl)-1,3-thiazol-2-yl]-N-(2,2,2-trifluoroethyl)pentanediamide.
| Compound Name | N'-[4-methyl-5-(2-pyridin-4-ylethynyl)-1,3-thiazol-2-yl]-N-(2,2,2-trifluoroethyl)pentanediamide |
|---|---|
| PubChem CID | 59615749 |
| Molecular Formula | C18H17F3N4O2S |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | N'-[4-methyl-5-(2-pyridin-4-ylethynyl)-1,3-thiazol-2-yl]-N-(2,2,2-trifluoroethyl)pentanediamide |
| SMILES | Cc1nc(NC(=O)CCCC(=O)NCC(F)(F)F)sc1C#Cc1ccncc1 |
| InChI | InChI=1S/C18H17F3N4O2S/c1-12-14(6-5-13-7-9-22-10-8-13)28-17(24-12)25-16(27)4-2-3-15(26)23-11-18(19,20)21/h7-10H,2-4,11H2,1H3,(H,23,26)(H,24,25,27) |
| InChIKey | PLJHHAZGNDJYGG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|