About 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxyethyl 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate
2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxyethyl 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 59616282) has the molecular formula C13H14F2O9S
and a molecular weight of 384.31 g/mol. Its IUPAC name is 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxyethyl 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
Molecular Properties
| Compound Name | 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxyethyl 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| PubChem CID | 59616282 |
| Molecular Formula | C13H14F2O9S |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxyethyl 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | O=C(OCCOC(=O)C(F)(F)SOOO)C1C2CC3OC(=O)C1C3C2 |
| InChI | InChI=1S/C13H14F2O9S/c14-13(15,25-24-23-19)12(18)21-2-1-20-10(16)8-5-3-6-7(4-5)22-11(17)9(6)8/h5-9,19H,1-4H2 |
| InChIKey | JULFDPOLWCTBIT-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxyethyl 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxyethyl 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
The IUPAC name of 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxyethyl 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (CID 59616282) is 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxyethyl 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
What is the SMILES notation for 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxyethyl 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
The canonical SMILES for 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxyethyl 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate is O=C(OCCOC(=O)C(F)(F)SOOO)C1C2CC3OC(=O)C1C3C2.
What is the InChIKey of 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxyethyl 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
The InChIKey is JULFDPOLWCTBIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2O9S/c14-13(15,25-24-23-19)12(18)21-2-1-20-10(16)8-5-3-6-7(4-5)22-11(17)9(6)8/h5-9,19H,1-4H2.
What are the key properties of 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxyethyl 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate?
2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxyethyl 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate has a molecular weight of 384.31 g/mol, XLogP of 0.93, 8 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxyethyl 5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate is sourced from PubChem (CID 59616282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).