C26H36O7 — CID 59616435
(2S,4S,5R)-2-[3-(3-methylspiro[dioxetane-4,13'-tricyclo[7.3.1.02,7]tridecane]-3-yl)phenoxy]oxane-3,4,5-triol (PubChem CID 59616435) has the molecular formula C26H36O7 and a molecular weight of 460.57 g/mol. Its IUPAC name is (2S,4S,5R)-2-[3-(3-methylspiro[dioxetane-4,13'-tricyclo[7.3.1.02,7]tridecane]-3-yl)phenoxy]oxane-3,4,5-triol.
| Compound Name | (2S,4S,5R)-2-[3-(3-methylspiro[dioxetane-4,13'-tricyclo[7.3.1.02,7]tridecane]-3-yl)phenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59616435 |
| Molecular Formula | C26H36O7 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | (2S,4S,5R)-2-[3-(3-methylspiro[dioxetane-4,13'-tricyclo[7.3.1.02,7]tridecane]-3-yl)phenoxy]oxane-3,4,5-triol |
| SMILES | CC1(c2cccc(O[C@@H]3OC[C@@H](O)[C@H](O)C3O)c2)OOC12C1CCCC2C2CCCCC2C1 |
| InChI | InChI=1S/C26H36O7/c1-25(16-7-4-9-18(13-16)31-24-23(29)22(28)21(27)14-30-24)26(33-32-25)17-8-5-11-20(26)19-10-3-2-6-15(19)12-17/h4,7,9,13,15,17,19-24,27-29H,2-3,5-6,8,10-12,14H2,1H3/t15?,17?,19?,20?,21-,22+,23?,24+,25?,26?/m1/s1 |
| InChIKey | UKGORAYKDMGFFL-ALJLOQRUSA-N |
| XLogP | 3.05 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|