C11H23NO2S — CID 59616707
(3R,5R)-4-methanidyl-3,5-di(propan-2-yl)-1,4-thiazinan-4-ium 1,1-dioxide (PubChem CID 59616707) has the molecular formula C11H23NO2S and a molecular weight of 233.38 g/mol. Its IUPAC name is (3R,5R)-4-methanidyl-3,5-di(propan-2-yl)-1,4-thiazinan-4-ium 1,1-dioxide.
| Compound Name | (3R,5R)-4-methanidyl-3,5-di(propan-2-yl)-1,4-thiazinan-4-ium 1,1-dioxide |
|---|---|
| PubChem CID | 59616707 |
| Molecular Formula | C11H23NO2S |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (3R,5R)-4-methanidyl-3,5-di(propan-2-yl)-1,4-thiazinan-4-ium 1,1-dioxide |
| SMILES | [CH2-][NH+]1[C@H](C(C)C)CS(=O)(=O)C[C@H]1C(C)C |
| InChI | InChI=1S/C11H23NO2S/c1-8(2)10-6-15(13,14)7-11(9(3)4)12(10)5/h8-12H,5-7H2,1-4H3/t10-,11-/m0/s1 |
| InChIKey | TYXLDZFAVTXWGN-QWRGUYRKSA-N |
| XLogP | 0.14 |
| TPSA | 38.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|