About 2,5-ditert-butyl-1-propan-2-yl-2,5-dihydropyrrole
2,5-ditert-butyl-1-propan-2-yl-2,5-dihydropyrrole (PubChem CID 59616715) has the molecular formula C15H29N
and a molecular weight of 223.40 g/mol. Its IUPAC name is 2,5-ditert-butyl-1-propan-2-yl-2,5-dihydropyrrole.
Molecular Properties
| Compound Name | 2,5-ditert-butyl-1-propan-2-yl-2,5-dihydropyrrole |
| PubChem CID | 59616715 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | 2,5-ditert-butyl-1-propan-2-yl-2,5-dihydropyrrole |
| SMILES | CC(C)N1C(C(C)(C)C)C=CC1C(C)(C)C |
| InChI | InChI=1S/C15H29N/c1-11(2)16-12(14(3,4)5)9-10-13(16)15(6,7)8/h9-13H,1-8H3 |
| InChIKey | KOZDREVHECGPST-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-ditert-butyl-1-propan-2-yl-2,5-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-ditert-butyl-1-propan-2-yl-2,5-dihydropyrrole?
The IUPAC name of 2,5-ditert-butyl-1-propan-2-yl-2,5-dihydropyrrole (CID 59616715) is 2,5-ditert-butyl-1-propan-2-yl-2,5-dihydropyrrole.
What is the SMILES notation for 2,5-ditert-butyl-1-propan-2-yl-2,5-dihydropyrrole?
The canonical SMILES for 2,5-ditert-butyl-1-propan-2-yl-2,5-dihydropyrrole is CC(C)N1C(C(C)(C)C)C=CC1C(C)(C)C.
What is the InChIKey of 2,5-ditert-butyl-1-propan-2-yl-2,5-dihydropyrrole?
The InChIKey is KOZDREVHECGPST-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N/c1-11(2)16-12(14(3,4)5)9-10-13(16)15(6,7)8/h9-13H,1-8H3.
What are the key properties of 2,5-ditert-butyl-1-propan-2-yl-2,5-dihydropyrrole?
2,5-ditert-butyl-1-propan-2-yl-2,5-dihydropyrrole has a molecular weight of 223.40 g/mol, XLogP of 4.10, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-ditert-butyl-1-propan-2-yl-2,5-dihydropyrrole is sourced from PubChem (CID 59616715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).