About 3,5-ditert-butyl-4-propan-2-yl-2,3-dihydrofuran
3,5-ditert-butyl-4-propan-2-yl-2,3-dihydrofuran (PubChem CID 59616734) has the molecular formula C15H28O
and a molecular weight of 224.39 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-propan-2-yl-2,3-dihydrofuran.
Molecular Properties
| Compound Name | 3,5-ditert-butyl-4-propan-2-yl-2,3-dihydrofuran |
| PubChem CID | 59616734 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 3,5-ditert-butyl-4-propan-2-yl-2,3-dihydrofuran |
| SMILES | CC(C)C1=C(C(C)(C)C)OCC1C(C)(C)C |
| InChI | InChI=1S/C15H28O/c1-10(2)12-11(14(3,4)5)9-16-13(12)15(6,7)8/h10-11H,9H2,1-8H3 |
| InChIKey | JXHNPAAZMHNYSJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-ditert-butyl-4-propan-2-yl-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-ditert-butyl-4-propan-2-yl-2,3-dihydrofuran?
The IUPAC name of 3,5-ditert-butyl-4-propan-2-yl-2,3-dihydrofuran (CID 59616734) is 3,5-ditert-butyl-4-propan-2-yl-2,3-dihydrofuran.
What is the SMILES notation for 3,5-ditert-butyl-4-propan-2-yl-2,3-dihydrofuran?
The canonical SMILES for 3,5-ditert-butyl-4-propan-2-yl-2,3-dihydrofuran is CC(C)C1=C(C(C)(C)C)OCC1C(C)(C)C.
What is the InChIKey of 3,5-ditert-butyl-4-propan-2-yl-2,3-dihydrofuran?
The InChIKey is JXHNPAAZMHNYSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O/c1-10(2)12-11(14(3,4)5)9-16-13(12)15(6,7)8/h10-11H,9H2,1-8H3.
What are the key properties of 3,5-ditert-butyl-4-propan-2-yl-2,3-dihydrofuran?
3,5-ditert-butyl-4-propan-2-yl-2,3-dihydrofuran has a molecular weight of 224.39 g/mol, XLogP of 4.64, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-ditert-butyl-4-propan-2-yl-2,3-dihydrofuran is sourced from PubChem (CID 59616734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).