About 2,4-ditert-butyl-3-propan-2-yl-2,5-dihydrothiophene
2,4-ditert-butyl-3-propan-2-yl-2,5-dihydrothiophene (PubChem CID 59616755) has the molecular formula C15H28S
and a molecular weight of 240.46 g/mol. Its IUPAC name is 2,4-ditert-butyl-3-propan-2-yl-2,5-dihydrothiophene.
Molecular Properties
| Compound Name | 2,4-ditert-butyl-3-propan-2-yl-2,5-dihydrothiophene |
| PubChem CID | 59616755 |
| Molecular Formula | C15H28S |
| Molecular Weight | 240.46 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 2,4-ditert-butyl-3-propan-2-yl-2,5-dihydrothiophene |
| SMILES | CC(C)C1=C(C(C)(C)C)CSC1C(C)(C)C |
| InChI | InChI=1S/C15H28S/c1-10(2)12-11(14(3,4)5)9-16-13(12)15(6,7)8/h10,13H,9H2,1-8H3 |
| InChIKey | FUPCLKHJUXXCPI-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,4-ditert-butyl-3-propan-2-yl-2,5-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-ditert-butyl-3-propan-2-yl-2,5-dihydrothiophene?
The IUPAC name of 2,4-ditert-butyl-3-propan-2-yl-2,5-dihydrothiophene (CID 59616755) is 2,4-ditert-butyl-3-propan-2-yl-2,5-dihydrothiophene.
What is the SMILES notation for 2,4-ditert-butyl-3-propan-2-yl-2,5-dihydrothiophene?
The canonical SMILES for 2,4-ditert-butyl-3-propan-2-yl-2,5-dihydrothiophene is CC(C)C1=C(C(C)(C)C)CSC1C(C)(C)C.
What is the InChIKey of 2,4-ditert-butyl-3-propan-2-yl-2,5-dihydrothiophene?
The InChIKey is FUPCLKHJUXXCPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28S/c1-10(2)12-11(14(3,4)5)9-16-13(12)15(6,7)8/h10,13H,9H2,1-8H3.
What are the key properties of 2,4-ditert-butyl-3-propan-2-yl-2,5-dihydrothiophene?
2,4-ditert-butyl-3-propan-2-yl-2,5-dihydrothiophene has a molecular weight of 240.46 g/mol, XLogP of 5.15, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-ditert-butyl-3-propan-2-yl-2,5-dihydrothiophene is sourced from PubChem (CID 59616755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).