About 3,5-ditert-butyl-4-propan-2-yl-2H-1,3-thiazole
3,5-ditert-butyl-4-propan-2-yl-2H-1,3-thiazole (PubChem CID 59616803) has the molecular formula C14H27NS
and a molecular weight of 241.44 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-propan-2-yl-2H-1,3-thiazole.
Molecular Properties
| Compound Name | 3,5-ditert-butyl-4-propan-2-yl-2H-1,3-thiazole |
| PubChem CID | 59616803 |
| Molecular Formula | C14H27NS |
| Molecular Weight | 241.44 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | 3,5-ditert-butyl-4-propan-2-yl-2H-1,3-thiazole |
| SMILES | CC(C)C1=C(C(C)(C)C)SCN1C(C)(C)C |
| InChI | InChI=1S/C14H27NS/c1-10(2)11-12(13(3,4)5)16-9-15(11)14(6,7)8/h10H,9H2,1-8H3 |
| InChIKey | VHHPGWZJYHOSAW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-ditert-butyl-4-propan-2-yl-2H-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-ditert-butyl-4-propan-2-yl-2H-1,3-thiazole?
The IUPAC name of 3,5-ditert-butyl-4-propan-2-yl-2H-1,3-thiazole (CID 59616803) is 3,5-ditert-butyl-4-propan-2-yl-2H-1,3-thiazole.
What is the SMILES notation for 3,5-ditert-butyl-4-propan-2-yl-2H-1,3-thiazole?
The canonical SMILES for 3,5-ditert-butyl-4-propan-2-yl-2H-1,3-thiazole is CC(C)C1=C(C(C)(C)C)SCN1C(C)(C)C.
What is the InChIKey of 3,5-ditert-butyl-4-propan-2-yl-2H-1,3-thiazole?
The InChIKey is VHHPGWZJYHOSAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NS/c1-10(2)11-12(13(3,4)5)16-9-15(11)14(6,7)8/h10H,9H2,1-8H3.
What are the key properties of 3,5-ditert-butyl-4-propan-2-yl-2H-1,3-thiazole?
3,5-ditert-butyl-4-propan-2-yl-2H-1,3-thiazole has a molecular weight of 241.44 g/mol, XLogP of 4.70, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-ditert-butyl-4-propan-2-yl-2H-1,3-thiazole is sourced from PubChem (CID 59616803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).