About 5,6,7-trimethyl-5,7-dihydropyrrolo[3,4-b]pyridine
5,6,7-trimethyl-5,7-dihydropyrrolo[3,4-b]pyridine (PubChem CID 59616840) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 5,6,7-trimethyl-5,7-dihydropyrrolo[3,4-b]pyridine.
Analyze 5,6,7-trimethyl-5,7-dihydropyrrolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6,7-trimethyl-5,7-dihydropyrrolo[3,4-b]pyridine?
The IUPAC name of 5,6,7-trimethyl-5,7-dihydropyrrolo[3,4-b]pyridine (CID 59616840) is 5,6,7-trimethyl-5,7-dihydropyrrolo[3,4-b]pyridine.
What is the SMILES notation for 5,6,7-trimethyl-5,7-dihydropyrrolo[3,4-b]pyridine?
The canonical SMILES for 5,6,7-trimethyl-5,7-dihydropyrrolo[3,4-b]pyridine is CC1c2cccnc2C(C)N1C.
What is the InChIKey of 5,6,7-trimethyl-5,7-dihydropyrrolo[3,4-b]pyridine?
The InChIKey is WUQOSKUUSAFKCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-7-9-5-4-6-11-10(9)8(2)12(7)3/h4-8H,1-3H3.
What are the key properties of 5,6,7-trimethyl-5,7-dihydropyrrolo[3,4-b]pyridine?
5,6,7-trimethyl-5,7-dihydropyrrolo[3,4-b]pyridine has a molecular weight of 162.24 g/mol, XLogP of 2.15, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,7-trimethyl-5,7-dihydropyrrolo[3,4-b]pyridine is sourced from PubChem (CID 59616840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).