C12H17NO2 — CID 59616949
(2S,3R,4R,5S)-2,5-dimethyl-1-phenylpyrrolidine-3,4-diol (PubChem CID 59616949) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2,5-dimethyl-1-phenylpyrrolidine-3,4-diol.
| Compound Name | (2S,3R,4R,5S)-2,5-dimethyl-1-phenylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 59616949 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (2S,3R,4R,5S)-2,5-dimethyl-1-phenylpyrrolidine-3,4-diol |
| SMILES | C[C@H]1[C@@H](O)[C@H](O)[C@H](C)N1c1ccccc1 |
| InChI | InChI=1S/C12H17NO2/c1-8-11(14)12(15)9(2)13(8)10-6-4-3-5-7-10/h3-9,11-12,14-15H,1-2H3/t8-,9-,11+,12+/m0/s1 |
| InChIKey | KYERSUKVSZJJRW-GAIPPQHRSA-N |
| XLogP | 1.01 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |