C16H16N2O6 — CID 59617000
(1R,4R)-1,4-bis(4-nitrophenyl)butane-1,4-diol (PubChem CID 59617000) has the molecular formula C16H16N2O6 and a molecular weight of 332.31 g/mol. Its IUPAC name is (1R,4R)-1,4-bis(4-nitrophenyl)butane-1,4-diol.
| Compound Name | (1R,4R)-1,4-bis(4-nitrophenyl)butane-1,4-diol |
|---|---|
| PubChem CID | 59617000 |
| Molecular Formula | C16H16N2O6 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (1R,4R)-1,4-bis(4-nitrophenyl)butane-1,4-diol |
| SMILES | O=[N+]([O-])c1ccc([C@H](O)CC[C@@H](O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C16H16N2O6/c19-15(11-1-5-13(6-2-11)17(21)22)9-10-16(20)12-3-7-14(8-4-12)18(23)24/h1-8,15-16,19-20H,9-10H2/t15-,16-/m1/s1 |
| InChIKey | UWHDPSHAHWBHHT-HZPDHXFCSA-N |
| XLogP | 3.05 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|