About 1-deuterio-2,5-bis(4-ethynylphenyl)pyrrole
1-deuterio-2,5-bis(4-ethynylphenyl)pyrrole (PubChem CID 59617013) has the molecular formula C20H13N
and a molecular weight of 268.34 g/mol. Its IUPAC name is 1-deuterio-2,5-bis(4-ethynylphenyl)pyrrole.
Molecular Properties
| Compound Name | 1-deuterio-2,5-bis(4-ethynylphenyl)pyrrole |
| PubChem CID | 59617013 |
| Molecular Formula | C20H13N |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1-deuterio-2,5-bis(4-ethynylphenyl)pyrrole |
| SMILES | [2H]n1c(-c2ccc(C#C)cc2)ccc1-c1ccc(C#C)cc1 |
| InChI | InChI=1S/C20H13N/c1-3-15-5-9-17(10-6-15)19-13-14-20(21-19)18-11-7-16(4-2)8-12-18/h1-2,5-14,21H/i/hD |
| InChIKey | FWXLTIIXGXHCOE-DYCDLGHISA-N |
| XLogP | 4.31 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-deuterio-2,5-bis(4-ethynylphenyl)pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-deuterio-2,5-bis(4-ethynylphenyl)pyrrole?
The IUPAC name of 1-deuterio-2,5-bis(4-ethynylphenyl)pyrrole (CID 59617013) is 1-deuterio-2,5-bis(4-ethynylphenyl)pyrrole.
What is the SMILES notation for 1-deuterio-2,5-bis(4-ethynylphenyl)pyrrole?
The canonical SMILES for 1-deuterio-2,5-bis(4-ethynylphenyl)pyrrole is [2H]n1c(-c2ccc(C#C)cc2)ccc1-c1ccc(C#C)cc1.
What is the InChIKey of 1-deuterio-2,5-bis(4-ethynylphenyl)pyrrole?
The InChIKey is FWXLTIIXGXHCOE-DYCDLGHISA-N. The full InChI is InChI=1S/C20H13N/c1-3-15-5-9-17(10-6-15)19-13-14-20(21-19)18-11-7-16(4-2)8-12-18/h1-2,5-14,21H/i/hD.
What are the key properties of 1-deuterio-2,5-bis(4-ethynylphenyl)pyrrole?
1-deuterio-2,5-bis(4-ethynylphenyl)pyrrole has a molecular weight of 268.34 g/mol, XLogP of 4.31, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-deuterio-2,5-bis(4-ethynylphenyl)pyrrole is sourced from PubChem (CID 59617013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).