C34H47N2O9P — CID 59617595
[1-[2-[(3R,5S,8S)-8-tert-butyl-18-methoxy-7,10-dioxo-2,11-dioxa-6,23-diazatetracyclo[15.6.2.13,6.020,24]hexacosa-1(23),17,19,21,24-pentaen-5-yl]-2-oxoethyl]-2-ethylcyclopropyl]phosphonic acid (PubChem CID 59617595) has the molecular formula C34H47N2O9P and a molecular weight of 658.73 g/mol. Its IUPAC name is [1-[2-[(3R,5S,8S)-8-tert-butyl-18-methoxy-7,10-dioxo-2,11-dioxa-6,23-diazatetracyclo[15.6.2.13,6.020,24]hexacosa-1(23),17,19,21,24-pentaen-5-yl]-2-oxoethyl]-2-ethylcyclopropyl]phosphonic acid.
| Compound Name | [1-[2-[(3R,5S,8S)-8-tert-butyl-18-methoxy-7,10-dioxo-2,11-dioxa-6,23-diazatetracyclo[15.6.2.13,6.020,24]hexacosa-1(23),17,19,21,24-pentaen-5-yl]-2-oxoethyl]-2-ethylcyclopropyl]phosphonic acid |
|---|---|
| PubChem CID | 59617595 |
| Molecular Formula | C34H47N2O9P |
| Molecular Weight | 658.73 g/mol |
| Exact Mass | 658.30 |
| IUPAC Name | [1-[2-[(3R,5S,8S)-8-tert-butyl-18-methoxy-7,10-dioxo-2,11-dioxa-6,23-diazatetracyclo[15.6.2.13,6.020,24]hexacosa-1(23),17,19,21,24-pentaen-5-yl]-2-oxoethyl]-2-ethylcyclopropyl]phosphonic acid |
| SMILES | CCC1CC1(CC(=O)[C@@H]1C[C@@H]2CN1C(=O)[C@H](C(C)(C)C)CC(=O)OCCCCCc1cc3c(nccc3cc1OC)O2)P(=O)(O)O |
| InChI | InChI=1S/C34H47N2O9P/c1-6-23-18-34(23,46(40,41)42)19-28(37)27-16-24-20-36(27)32(39)26(33(2,3)4)17-30(38)44-13-9-7-8-10-22-14-25-21(15-29(22)43-5)11-12-35-31(25)45-24/h11-12,14-15,23-24,26-27H,6-10,13,16-20H2,1-5H3,(H2,40,41,42)/t23?,24-,26-,27+,34?/m1/s1 |
| InChIKey | ZIZJIGFIDRLROY-UBYLPNTJSA-N |
| XLogP | 5.22 |
| TPSA | 152.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.73 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|