About N-(2-anilino-4-pyridinyl)-2,6-dichlorobenzamide
N-(2-anilino-4-pyridinyl)-2,6-dichlorobenzamide (PubChem CID 59618117) has the molecular formula C18H13Cl2N3O
and a molecular weight of 358.23 g/mol. Its IUPAC name is N-(2-anilino-4-pyridinyl)-2,6-dichlorobenzamide.
Molecular Properties
| Compound Name | N-(2-anilino-4-pyridinyl)-2,6-dichlorobenzamide |
| PubChem CID | 59618117 |
| Molecular Formula | C18H13Cl2N3O |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | N-(2-anilino-4-pyridinyl)-2,6-dichlorobenzamide |
| SMILES | O=C(Nc1ccnc(Nc2ccccc2)c1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H13Cl2N3O/c19-14-7-4-8-15(20)17(14)18(24)23-13-9-10-21-16(11-13)22-12-5-2-1-3-6-12/h1-11H,(H2,21,22,23,24) |
| InChIKey | DAPDNKHRFLGXBE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-anilino-4-pyridinyl)-2,6-dichlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-anilino-4-pyridinyl)-2,6-dichlorobenzamide?
The IUPAC name of N-(2-anilino-4-pyridinyl)-2,6-dichlorobenzamide (CID 59618117) is N-(2-anilino-4-pyridinyl)-2,6-dichlorobenzamide.
What is the SMILES notation for N-(2-anilino-4-pyridinyl)-2,6-dichlorobenzamide?
The canonical SMILES for N-(2-anilino-4-pyridinyl)-2,6-dichlorobenzamide is O=C(Nc1ccnc(Nc2ccccc2)c1)c1c(Cl)cccc1Cl.
What is the InChIKey of N-(2-anilino-4-pyridinyl)-2,6-dichlorobenzamide?
The InChIKey is DAPDNKHRFLGXBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Cl2N3O/c19-14-7-4-8-15(20)17(14)18(24)23-13-9-10-21-16(11-13)22-12-5-2-1-3-6-12/h1-11H,(H2,21,22,23,24).
What are the key properties of N-(2-anilino-4-pyridinyl)-2,6-dichlorobenzamide?
N-(2-anilino-4-pyridinyl)-2,6-dichlorobenzamide has a molecular weight of 358.23 g/mol, XLogP of 5.38, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-anilino-4-pyridinyl)-2,6-dichlorobenzamide is sourced from PubChem (CID 59618117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).