C23H23F3N4O2S — CID 59618620
10-(4-tert-butylphenyl)sulfonyl-13-methyl-5-(trifluoromethyl)-2,4,10,12-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene (PubChem CID 59618620) has the molecular formula C23H23F3N4O2S and a molecular weight of 476.52 g/mol. Its IUPAC name is 10-(4-tert-butylphenyl)sulfonyl-13-methyl-5-(trifluoromethyl)-2,4,10,12-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene.
| Compound Name | 10-(4-tert-butylphenyl)sulfonyl-13-methyl-5-(trifluoromethyl)-2,4,10,12-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
|---|---|
| PubChem CID | 59618620 |
| Molecular Formula | C23H23F3N4O2S |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 10-(4-tert-butylphenyl)sulfonyl-13-methyl-5-(trifluoromethyl)-2,4,10,12-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| SMILES | Cc1ccc2c(n1)N(S(=O)(=O)c1ccc(C(C)(C)C)cc1)Cc1ccc(C(F)(F)F)nc1N2 |
| InChI | InChI=1S/C23H23F3N4O2S/c1-14-5-11-18-21(27-14)30(13-15-6-12-19(23(24,25)26)29-20(15)28-18)33(31,32)17-9-7-16(8-10-17)22(2,3)4/h5-12H,13H2,1-4H3,(H,28,29) |
| InChIKey | YBWCQZMBZFDPJG-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |