C26H23F3N4O2S — CID 59618681
10-(4-tert-butylphenyl)sulfonyl-5-(trifluoromethyl)-2,4,10,16-tetrazatetracyclo[9.8.0.03,8.012,17]nonadeca-1(11),3(8),4,6,12(17),13,15,18-octaene (PubChem CID 59618681) has the molecular formula C26H23F3N4O2S and a molecular weight of 512.56 g/mol. Its IUPAC name is 10-(4-tert-butylphenyl)sulfonyl-5-(trifluoromethyl)-2,4,10,16-tetrazatetracyclo[9.8.0.03,8.012,17]nonadeca-1(11),3(8),4,6,12(17),13,15,18-octaene.
| Compound Name | 10-(4-tert-butylphenyl)sulfonyl-5-(trifluoromethyl)-2,4,10,16-tetrazatetracyclo[9.8.0.03,8.012,17]nonadeca-1(11),3(8),4,6,12(17),13,15,18-octaene |
|---|---|
| PubChem CID | 59618681 |
| Molecular Formula | C26H23F3N4O2S |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 10-(4-tert-butylphenyl)sulfonyl-5-(trifluoromethyl)-2,4,10,16-tetrazatetracyclo[9.8.0.03,8.012,17]nonadeca-1(11),3(8),4,6,12(17),13,15,18-octaene |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2Cc3ccc(C(F)(F)F)nc3Nc3ccc4ncccc4c32)cc1 |
| InChI | InChI=1S/C26H23F3N4O2S/c1-25(2,3)17-7-9-18(10-8-17)36(34,35)33-15-16-6-13-22(26(27,28)29)32-24(16)31-21-12-11-20-19(23(21)33)5-4-14-30-20/h4-14H,15H2,1-3H3,(H,31,32) |
| InChIKey | SMQOEXFVZFKSHV-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |