About 2-methyl-N-(3-methyl-2H-pyrazolo[4,3-c]pyridin-4-yl)-1,3-benzothiazol-5-amine
2-methyl-N-(3-methyl-2H-pyrazolo[4,3-c]pyridin-4-yl)-1,3-benzothiazol-5-amine (PubChem CID 59618975) has the molecular formula C15H13N5S
and a molecular weight of 295.37 g/mol. Its IUPAC name is 2-methyl-N-(3-methyl-2H-pyrazolo[4,3-c]pyridin-4-yl)-1,3-benzothiazol-5-amine.
Molecular Properties
| Compound Name | 2-methyl-N-(3-methyl-2H-pyrazolo[4,3-c]pyridin-4-yl)-1,3-benzothiazol-5-amine |
| PubChem CID | 59618975 |
| Molecular Formula | C15H13N5S |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-methyl-N-(3-methyl-2H-pyrazolo[4,3-c]pyridin-4-yl)-1,3-benzothiazol-5-amine |
| SMILES | Cc1nc2cc(Nc3nccc4n[nH]c(C)c34)ccc2s1 |
| InChI | InChI=1S/C15H13N5S/c1-8-14-11(20-19-8)5-6-16-15(14)18-10-3-4-13-12(7-10)17-9(2)21-13/h3-7H,1-2H3,(H,16,18)(H,19,20) |
| InChIKey | CWMSMNFXAHNGMK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-N-(3-methyl-2H-pyrazolo[4,3-c]pyridin-4-yl)-1,3-benzothiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(3-methyl-2H-pyrazolo[4,3-c]pyridin-4-yl)-1,3-benzothiazol-5-amine?
The IUPAC name of 2-methyl-N-(3-methyl-2H-pyrazolo[4,3-c]pyridin-4-yl)-1,3-benzothiazol-5-amine (CID 59618975) is 2-methyl-N-(3-methyl-2H-pyrazolo[4,3-c]pyridin-4-yl)-1,3-benzothiazol-5-amine.
What is the SMILES notation for 2-methyl-N-(3-methyl-2H-pyrazolo[4,3-c]pyridin-4-yl)-1,3-benzothiazol-5-amine?
The canonical SMILES for 2-methyl-N-(3-methyl-2H-pyrazolo[4,3-c]pyridin-4-yl)-1,3-benzothiazol-5-amine is Cc1nc2cc(Nc3nccc4n[nH]c(C)c34)ccc2s1.
What is the InChIKey of 2-methyl-N-(3-methyl-2H-pyrazolo[4,3-c]pyridin-4-yl)-1,3-benzothiazol-5-amine?
The InChIKey is CWMSMNFXAHNGMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N5S/c1-8-14-11(20-19-8)5-6-16-15(14)18-10-3-4-13-12(7-10)17-9(2)21-13/h3-7H,1-2H3,(H,16,18)(H,19,20).
What are the key properties of 2-methyl-N-(3-methyl-2H-pyrazolo[4,3-c]pyridin-4-yl)-1,3-benzothiazol-5-amine?
2-methyl-N-(3-methyl-2H-pyrazolo[4,3-c]pyridin-4-yl)-1,3-benzothiazol-5-amine has a molecular weight of 295.37 g/mol, XLogP of 3.93, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(3-methyl-2H-pyrazolo[4,3-c]pyridin-4-yl)-1,3-benzothiazol-5-amine is sourced from PubChem (CID 59618975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).