C25H28F3N3O5S — CID 59619256
(1R,2R,4R)-N-(1-cyanocyclopropyl)-4-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-2-(trifluoromethyl)phenyl]sulfonyl-2-propan-2-yloxycyclopentane-1-carboxamide (PubChem CID 59619256) has the molecular formula C25H28F3N3O5S and a molecular weight of 539.58 g/mol. Its IUPAC name is (1R,2R,4R)-N-(1-cyanocyclopropyl)-4-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-2-(trifluoromethyl)phenyl]sulfonyl-2-propan-2-yloxycyclopentane-1-carboxamide.
| Compound Name | (1R,2R,4R)-N-(1-cyanocyclopropyl)-4-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-2-(trifluoromethyl)phenyl]sulfonyl-2-propan-2-yloxycyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 59619256 |
| Molecular Formula | C25H28F3N3O5S |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | (1R,2R,4R)-N-(1-cyanocyclopropyl)-4-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-2-(trifluoromethyl)phenyl]sulfonyl-2-propan-2-yloxycyclopentane-1-carboxamide |
| SMILES | Cc1noc(C)c1-c1ccc(S(=O)(=O)[C@H]2C[C@@H](OC(C)C)[C@H](C(=O)NC3(C#N)CC3)C2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H28F3N3O5S/c1-13(2)35-20-11-17(10-18(20)23(32)30-24(12-29)7-8-24)37(33,34)21-6-5-16(9-19(21)25(26,27)28)22-14(3)31-36-15(22)4/h5-6,9,13,17-18,20H,7-8,10-11H2,1-4H3,(H,30,32)/t17-,18-,20-/m1/s1 |
| InChIKey | OJYDXQIALGMRQS-QWFCFKBJSA-N |
| XLogP | 4.50 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |