About trans-ethyl (1R,2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methanidylcyclopentane-1-carboxylate;yttrium
trans-ethyl (1R,2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methanidylcyclopentane-1-carboxylate;yttrium (PubChem CID 59619268) has the molecular formula C15H29O3SiY-
and a molecular weight of 374.39 g/mol. Its IUPAC name is trans-ethyl (1R,2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methanidylcyclopentane-1-carboxylate;yttrium.
Molecular Properties
| Compound Name | trans-ethyl (1R,2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methanidylcyclopentane-1-carboxylate;yttrium |
| PubChem CID | 59619268 |
| Molecular Formula | C15H29O3SiY- |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | trans-ethyl (1R,2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methanidylcyclopentane-1-carboxylate;yttrium |
| SMILES | [CH2-][C@@H]1CC(O[Si](C)(C)C(C)(C)C)C[C@H]1C(=O)OCC.[Y] |
| InChI | InChI=1S/C15H29O3Si.Y/c1-8-17-14(16)13-10-12(9-11(13)2)18-19(6,7)15(3,4)5;/h11-13H,2,8-10H2,1,3-7H3;/q-1;/t11-,12?,13-;/m1./s1 |
| InChIKey | DLIOVADQOIDFIM-XSKJWUEESA-N |
| XLogP | 3.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trans-ethyl (1R,2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methanidylcyclopentane-1-carboxylate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-ethyl (1R,2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methanidylcyclopentane-1-carboxylate;yttrium?
The IUPAC name of trans-ethyl (1R,2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methanidylcyclopentane-1-carboxylate;yttrium (CID 59619268) is trans-ethyl (1R,2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methanidylcyclopentane-1-carboxylate;yttrium.
What is the SMILES notation for trans-ethyl (1R,2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methanidylcyclopentane-1-carboxylate;yttrium?
The canonical SMILES for trans-ethyl (1R,2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methanidylcyclopentane-1-carboxylate;yttrium is [CH2-][C@@H]1CC(O[Si](C)(C)C(C)(C)C)C[C@H]1C(=O)OCC.[Y].
What is the InChIKey of trans-ethyl (1R,2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methanidylcyclopentane-1-carboxylate;yttrium?
The InChIKey is DLIOVADQOIDFIM-XSKJWUEESA-N. The full InChI is InChI=1S/C15H29O3Si.Y/c1-8-17-14(16)13-10-12(9-11(13)2)18-19(6,7)15(3,4)5;/h11-13H,2,8-10H2,1,3-7H3;/q-1;/t11-,12?,13-;/m1./s1.
What are the key properties of trans-ethyl (1R,2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methanidylcyclopentane-1-carboxylate;yttrium?
trans-ethyl (1R,2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methanidylcyclopentane-1-carboxylate;yttrium has a molecular weight of 374.39 g/mol, XLogP of 3.80, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-ethyl (1R,2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methanidylcyclopentane-1-carboxylate;yttrium is sourced from PubChem (CID 59619268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).