C21H20ClFN2O4S — CID 59619469
(1R,2R,4S)-4-(2-chlorophenyl)sulfonyl-N-(cyanomethyl)-2-[(4-fluorophenoxy)methyl]cyclopentane-1-carboxamide (PubChem CID 59619469) has the molecular formula C21H20ClFN2O4S and a molecular weight of 450.92 g/mol. Its IUPAC name is (1R,2R,4S)-4-(2-chlorophenyl)sulfonyl-N-(cyanomethyl)-2-[(4-fluorophenoxy)methyl]cyclopentane-1-carboxamide.
| Compound Name | (1R,2R,4S)-4-(2-chlorophenyl)sulfonyl-N-(cyanomethyl)-2-[(4-fluorophenoxy)methyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 59619469 |
| Molecular Formula | C21H20ClFN2O4S |
| Molecular Weight | 450.92 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | (1R,2R,4S)-4-(2-chlorophenyl)sulfonyl-N-(cyanomethyl)-2-[(4-fluorophenoxy)methyl]cyclopentane-1-carboxamide |
| SMILES | N#CCNC(=O)[C@@H]1C[C@@H](S(=O)(=O)c2ccccc2Cl)C[C@H]1COc1ccc(F)cc1 |
| InChI | InChI=1S/C21H20ClFN2O4S/c22-19-3-1-2-4-20(19)30(27,28)17-11-14(18(12-17)21(26)25-10-9-24)13-29-16-7-5-15(23)6-8-16/h1-8,14,17-18H,10-13H2,(H,25,26)/t14-,17-,18+/m0/s1 |
| InChIKey | YDTXPTPHJKOFHA-JCGIZDLHSA-N |
| XLogP | 3.37 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.92 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|