C14H11BrN4O3 — CID 59620045
N-(6-bromo-3-nitroquinolin-4-yl)-3,5-dimethyl-1,2-oxazol-4-amine (PubChem CID 59620045) has the molecular formula C14H11BrN4O3 and a molecular weight of 363.17 g/mol. Its IUPAC name is N-(6-bromo-3-nitroquinolin-4-yl)-3,5-dimethyl-1,2-oxazol-4-amine.
| Compound Name | N-(6-bromo-3-nitroquinolin-4-yl)-3,5-dimethyl-1,2-oxazol-4-amine |
|---|---|
| PubChem CID | 59620045 |
| Molecular Formula | C14H11BrN4O3 |
| Molecular Weight | 363.17 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | N-(6-bromo-3-nitroquinolin-4-yl)-3,5-dimethyl-1,2-oxazol-4-amine |
| SMILES | Cc1noc(C)c1Nc1c([N+](=O)[O-])cnc2ccc(Br)cc12 |
| InChI | InChI=1S/C14H11BrN4O3/c1-7-13(8(2)22-18-7)17-14-10-5-9(15)3-4-11(10)16-6-12(14)19(20)21/h3-6H,1-2H3,(H,16,17) |
| InChIKey | MRVXVEVEVSGXQX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.17 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|