About 1-(furan-3-yl)-2,9-dihydropyrido[3,4-b]indol-7-one
1-(furan-3-yl)-2,9-dihydropyrido[3,4-b]indol-7-one (PubChem CID 59620154) has the molecular formula C15H10N2O2
and a molecular weight of 250.26 g/mol. Its IUPAC name is 1-(furan-3-yl)-2,9-dihydropyrido[3,4-b]indol-7-one.
Molecular Properties
| Compound Name | 1-(furan-3-yl)-2,9-dihydropyrido[3,4-b]indol-7-one |
| PubChem CID | 59620154 |
| Molecular Formula | C15H10N2O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 1-(furan-3-yl)-2,9-dihydropyrido[3,4-b]indol-7-one |
| SMILES | O=c1ccc2c(c1)[nH]c1c(-c3ccoc3)[nH]ccc12 |
| InChI | InChI=1S/C15H10N2O2/c18-10-1-2-11-12-3-5-16-14(9-4-6-19-8-9)15(12)17-13(11)7-10/h1-8,16-17H |
| InChIKey | TZPWCZCCUOCEPR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(furan-3-yl)-2,9-dihydropyrido[3,4-b]indol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(furan-3-yl)-2,9-dihydropyrido[3,4-b]indol-7-one?
The IUPAC name of 1-(furan-3-yl)-2,9-dihydropyrido[3,4-b]indol-7-one (CID 59620154) is 1-(furan-3-yl)-2,9-dihydropyrido[3,4-b]indol-7-one.
What is the SMILES notation for 1-(furan-3-yl)-2,9-dihydropyrido[3,4-b]indol-7-one?
The canonical SMILES for 1-(furan-3-yl)-2,9-dihydropyrido[3,4-b]indol-7-one is O=c1ccc2c(c1)[nH]c1c(-c3ccoc3)[nH]ccc12.
What is the InChIKey of 1-(furan-3-yl)-2,9-dihydropyrido[3,4-b]indol-7-one?
The InChIKey is TZPWCZCCUOCEPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O2/c18-10-1-2-11-12-3-5-16-14(9-4-6-19-8-9)15(12)17-13(11)7-10/h1-8,16-17H.
What are the key properties of 1-(furan-3-yl)-2,9-dihydropyrido[3,4-b]indol-7-one?
1-(furan-3-yl)-2,9-dihydropyrido[3,4-b]indol-7-one has a molecular weight of 250.26 g/mol, XLogP of 3.27, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(furan-3-yl)-2,9-dihydropyrido[3,4-b]indol-7-one is sourced from PubChem (CID 59620154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).