About CID 59620693
CID 59620693 (PubChem CID 59620693) has the molecular formula C32H93NO20Si19
and a molecular weight of 1345.72 g/mol.
Molecular Properties
| Compound Name | CID 59620693 |
| PubChem CID | 59620693 |
| Molecular Formula | C32H93NO20Si19 |
| Molecular Weight | 1345.72 g/mol |
| Exact Mass | 1343.19 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)O[Si]O[Si]1(O[Si](C)(C)C)O[Si]2(O[Si](C)(C)C)O[Si]3(O[Si](C)(C)C)O[Si]O[Si]4(O[Si](C)(C)C)O[Si](O[Si](C)(C)C)(O3)O[Si](O[Si](C)(C)C)(O2)O[Si](O[Si](C)(C)CCCN([Si](C)(C)C)[Si](C)(C)C)(O1)O4 |
| InChI | InChI=1S/C32H93NO20Si19/c1-56(2,3)33(57(4,5)6)31-30-32-65(28,29)44-72-49-66(38-59(10,11)12,35-54-34-58(7,8)9)45-69(41-62(19,20)21)46-67(39-60(13,14)15)36-55-37-68(50-72,40-61(16,17)18)48-70(47-67,42-63(22,23)24)52-71(51-69,53-72)43-64(25,26)27/h30-32H2,1-29H3 |
| InChIKey | LFNNKPOBGYFUAH-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 187.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 72 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1345.72 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 21 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59620693 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59620693?
The IUPAC name of CID 59620693 (CID 59620693) is not available.
What is the SMILES notation for CID 59620693?
The canonical SMILES for CID 59620693 is C[Si](C)(C)O[Si]O[Si]1(O[Si](C)(C)C)O[Si]2(O[Si](C)(C)C)O[Si]3(O[Si](C)(C)C)O[Si]O[Si]4(O[Si](C)(C)C)O[Si](O[Si](C)(C)C)(O3)O[Si](O[Si](C)(C)C)(O2)O[Si](O[Si](C)(C)CCCN([Si](C)(C)C)[Si](C)(C)C)(O1)O4.
What is the InChIKey of CID 59620693?
The InChIKey is LFNNKPOBGYFUAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H93NO20Si19/c1-56(2,3)33(57(4,5)6)31-30-32-65(28,29)44-72-49-66(38-59(10,11)12,35-54-34-58(7,8)9)45-69(41-62(19,20)21)46-67(39-60(13,14)15)36-55-37-68(50-72,40-61(16,17)18)48-70(47-67,42-63(22,23)24)52-71(51-69,53-72)43-64(25,26)27/h30-32H2,1-29H3.
What are the key properties of CID 59620693?
CID 59620693 has a molecular weight of 1345.72 g/mol, XLogP of 8.90, 24 rotatable bonds, 0 hydrogen bond donors, and 21 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59620693 is sourced from PubChem (CID 59620693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).