About 3,7-dimethyloct-6-enyl 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate
3,7-dimethyloct-6-enyl 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate (PubChem CID 59620723) has the molecular formula C23H46O5SSi
and a molecular weight of 462.77 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate.
Molecular Properties
| Compound Name | 3,7-dimethyloct-6-enyl 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate |
| PubChem CID | 59620723 |
| Molecular Formula | C23H46O5SSi |
| Molecular Weight | 462.77 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | 3,7-dimethyloct-6-enyl 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate |
| SMILES | CCO[Si](CCCSC(C)(C)C(=O)OCCC(C)CCC=C(C)C)(OCC)OCC |
| InChI | InChI=1S/C23H46O5SSi/c1-9-26-30(27-10-2,28-11-3)19-13-18-29-23(7,8)22(24)25-17-16-21(6)15-12-14-20(4)5/h14,21H,9-13,15-19H2,1-8H3 |
| InChIKey | XFBXIVDRCOEZEF-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.77 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethyloct-6-enyl 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyloct-6-enyl 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate?
The IUPAC name of 3,7-dimethyloct-6-enyl 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate (CID 59620723) is 3,7-dimethyloct-6-enyl 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate.
What is the SMILES notation for 3,7-dimethyloct-6-enyl 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate?
The canonical SMILES for 3,7-dimethyloct-6-enyl 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate is CCO[Si](CCCSC(C)(C)C(=O)OCCC(C)CCC=C(C)C)(OCC)OCC.
What is the InChIKey of 3,7-dimethyloct-6-enyl 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate?
The InChIKey is XFBXIVDRCOEZEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H46O5SSi/c1-9-26-30(27-10-2,28-11-3)19-13-18-29-23(7,8)22(24)25-17-16-21(6)15-12-14-20(4)5/h14,21H,9-13,15-19H2,1-8H3.
What are the key properties of 3,7-dimethyloct-6-enyl 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate?
3,7-dimethyloct-6-enyl 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate has a molecular weight of 462.77 g/mol, XLogP of 6.25, 18 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyloct-6-enyl 2-methyl-2-(3-triethoxysilylpropylsulfanyl)propanoate is sourced from PubChem (CID 59620723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).